C16H15F2N3O — CID 7933313
2-anilino-N-[(Z)-1-(2,6-difluorophenyl)ethylideneamino]acetamide (PubChem CID 7933313) has the molecular formula C16H15F2N3O and a molecular weight of 303.31 g/mol. Its IUPAC name is 2-anilino-N-[(Z)-1-(2,6-difluorophenyl)ethylideneamino]acetamide.
| Compound Name | 2-anilino-N-[(Z)-1-(2,6-difluorophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 7933313 |
| Molecular Formula | C16H15F2N3O |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-anilino-N-[(Z)-1-(2,6-difluorophenyl)ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)CNc1ccccc1)c1c(F)cccc1F |
| InChI | InChI=1S/C16H15F2N3O/c1-11(16-13(17)8-5-9-14(16)18)20-21-15(22)10-19-12-6-3-2-4-7-12/h2-9,19H,10H2,1H3,(H,21,22)/b20-11- |
| InChIKey | NRARWOIAZAIAKM-JAIQZWGSSA-N |
| XLogP | 2.92 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|