C14H16N4OS — CID 97002883
2-anilino-N-[(E)-1-(4-methyl-1,3-thiazol-5-yl)ethylideneamino]acetamide (PubChem CID 97002883) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is 2-anilino-N-[(E)-1-(4-methyl-1,3-thiazol-5-yl)ethylideneamino]acetamide.
| Compound Name | 2-anilino-N-[(E)-1-(4-methyl-1,3-thiazol-5-yl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 97002883 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-anilino-N-[(E)-1-(4-methyl-1,3-thiazol-5-yl)ethylideneamino]acetamide |
| SMILES | C/C(=N\NC(=O)CNc1ccccc1)c1scnc1C |
| InChI | InChI=1S/C14H16N4OS/c1-10-14(20-9-16-10)11(2)17-18-13(19)8-15-12-6-4-3-5-7-12/h3-7,9,15H,8H2,1-2H3,(H,18,19)/b17-11+ |
| InChIKey | BMJFZQOLVITUDP-GZTJUZNOSA-N |
| XLogP | 2.40 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|