C18H21N3O4S — CID 48917207
2-anilino-N-[(E)-1-(3-methoxy-4-methylsulfonylphenyl)ethylideneamino]acetamide (PubChem CID 48917207) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-anilino-N-[(E)-1-(3-methoxy-4-methylsulfonylphenyl)ethylideneamino]acetamide.
| Compound Name | 2-anilino-N-[(E)-1-(3-methoxy-4-methylsulfonylphenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 48917207 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-anilino-N-[(E)-1-(3-methoxy-4-methylsulfonylphenyl)ethylideneamino]acetamide |
| SMILES | COc1cc(/C(C)=N/NC(=O)CNc2ccccc2)ccc1S(C)(=O)=O |
| InChI | InChI=1S/C18H21N3O4S/c1-13(14-9-10-17(26(3,23)24)16(11-14)25-2)20-21-18(22)12-19-15-7-5-4-6-8-15/h4-11,19H,12H2,1-3H3,(H,21,22)/b20-13+ |
| InChIKey | IKDZMEOEGIDGRZ-DEDYPNTBSA-N |
| XLogP | 2.05 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|