C19H17N3S — CID 75466690
(Z)-N-(benzhydrylideneamino)-1-(4-methyl-1,3-thiazol-5-yl)ethanimine (PubChem CID 75466690) has the molecular formula C19H17N3S and a molecular weight of 319.43 g/mol. Its IUPAC name is (Z)-N-(benzhydrylideneamino)-1-(4-methyl-1,3-thiazol-5-yl)ethanimine.
| Compound Name | (Z)-N-(benzhydrylideneamino)-1-(4-methyl-1,3-thiazol-5-yl)ethanimine |
|---|---|
| PubChem CID | 75466690 |
| Molecular Formula | C19H17N3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (Z)-N-(benzhydrylideneamino)-1-(4-methyl-1,3-thiazol-5-yl)ethanimine |
| SMILES | C/C(=N/N=C(c1ccccc1)c1ccccc1)c1scnc1C |
| InChI | InChI=1S/C19H17N3S/c1-14-19(23-13-20-14)15(2)21-22-18(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-13H,1-2H3/b21-15- |
| InChIKey | SCJKVQOLNFQSCT-QNGOZBTKSA-N |
| XLogP | 4.71 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|