C27H23ClN2Si — CID 102116978
N-[(benzhydrylideneamino)-chloro-methylsilyl]-1,1-diphenylmethanimine (PubChem CID 102116978) has the molecular formula C27H23ClN2Si and a molecular weight of 439.03 g/mol. Its IUPAC name is N-[(benzhydrylideneamino)-chloro-methylsilyl]-1,1-diphenylmethanimine.
| Compound Name | N-[(benzhydrylideneamino)-chloro-methylsilyl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 102116978 |
| Molecular Formula | C27H23ClN2Si |
| Molecular Weight | 439.03 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N-[(benzhydrylideneamino)-chloro-methylsilyl]-1,1-diphenylmethanimine |
| SMILES | C[Si](Cl)(N=C(c1ccccc1)c1ccccc1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H23ClN2Si/c1-31(28,29-26(22-14-6-2-7-15-22)23-16-8-3-9-17-23)30-27(24-18-10-4-11-19-24)25-20-12-5-13-21-25/h2-21H,1H3 |
| InChIKey | OKGZKIYABYIBJA-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.03 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|