C17H19N — CID 170780662
N-tert-butyl-1,1-diphenylmethan(15N)imine (PubChem CID 170780662) has the molecular formula C17H19N and a molecular weight of 238.34 g/mol. Its IUPAC name is N-tert-butyl-1,1-diphenylmethan(15N)imine.
| Compound Name | N-tert-butyl-1,1-diphenylmethan(15N)imine |
|---|---|
| PubChem CID | 170780662 |
| Molecular Formula | C17H19N |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N-tert-butyl-1,1-diphenylmethan(15N)imine |
| SMILES | CC(C)(C)[15N]=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19N/c1-17(2,3)18-16(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,1-3H3/i18+1 |
| InChIKey | FERNQUQHCNQEJZ-CPZJZEHKSA-N |
| XLogP | 4.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|