C16H24N2O — CID 11118811
N-(N-tert-butyl-C-phenylcarbonimidoyl)-2,2-dimethylpropanamide (PubChem CID 11118811) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is N-(N-tert-butyl-C-phenylcarbonimidoyl)-2,2-dimethylpropanamide.
| Compound Name | N-(N-tert-butyl-C-phenylcarbonimidoyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 11118811 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N-(N-tert-butyl-C-phenylcarbonimidoyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)/N=C(/NC(=O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H24N2O/c1-15(2,3)14(19)17-13(18-16(4,5)6)12-10-8-7-9-11-12/h7-11H,1-6H3,(H,17,18,19) |
| InChIKey | OYAXMUCHZVRCNG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|