C32H48Cl2N4O2Pd — CID 11433968
bis(N-(N-butyl-C-phenylcarbonimidoyl)-2,2-dimethylpropanamide);dichloropalladium (PubChem CID 11433968) has the molecular formula C32H48Cl2N4O2Pd and a molecular weight of 698.09 g/mol. Its IUPAC name is bis(N-(N-butyl-C-phenylcarbonimidoyl)-2,2-dimethylpropanamide);dichloropalladium.
| Compound Name | bis(N-(N-butyl-C-phenylcarbonimidoyl)-2,2-dimethylpropanamide);dichloropalladium |
|---|---|
| PubChem CID | 11433968 |
| Molecular Formula | C32H48Cl2N4O2Pd |
| Molecular Weight | 698.09 g/mol |
| Exact Mass | 696.22 |
| IUPAC Name | bis(N-(N-butyl-C-phenylcarbonimidoyl)-2,2-dimethylpropanamide);dichloropalladium |
| SMILES | CCCC/N=C(\NC(=O)C(C)(C)C)c1ccccc1.CCCC/N=C(\NC(=O)C(C)(C)C)c1ccccc1.Cl[Pd]Cl |
| InChI | InChI=1S/2C16H24N2O.2ClH.Pd/c2*1-5-6-12-17-14(13-10-8-7-9-11-13)18-15(19)16(2,3)4;;;/h2*7-11H,5-6,12H2,1-4H3,(H,17,18,19);2*1H;/q;;;;+2/p-2 |
| InChIKey | VXGZPGMEKNBYTB-UHFFFAOYSA-L |
| XLogP | 8.17 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.09 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|