C17H20N4O2 — CID 15406489
N-hydroxy-N'-[3-[[(hydroxyamino)-phenylmethylidene]amino]propyl]benzenecarboximidamide (PubChem CID 15406489) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-hydroxy-N'-[3-[[(hydroxyamino)-phenylmethylidene]amino]propyl]benzenecarboximidamide.
| Compound Name | N-hydroxy-N'-[3-[[(hydroxyamino)-phenylmethylidene]amino]propyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 15406489 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-hydroxy-N'-[3-[[(hydroxyamino)-phenylmethylidene]amino]propyl]benzenecarboximidamide |
| SMILES | ON/C(=N\CCC/N=C(\NO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20N4O2/c22-20-16(14-8-3-1-4-9-14)18-12-7-13-19-17(21-23)15-10-5-2-6-11-15/h1-6,8-11,22-23H,7,12-13H2,(H,18,20)(H,19,21) |
| InChIKey | ZJTGTNKVKDLBSA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|