C27H36N4O2 — CID 53483743
N-[N-[3-[[(2,2-dimethylpropanoylamino)-phenylmethylidene]amino]propyl]-C-phenylcarbonimidoyl]-2,2-dimethylpropanamide (PubChem CID 53483743) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is N-[N-[3-[[(2,2-dimethylpropanoylamino)-phenylmethylidene]amino]propyl]-C-phenylcarbonimidoyl]-2,2-dimethylpropanamide.
| Compound Name | N-[N-[3-[[(2,2-dimethylpropanoylamino)-phenylmethylidene]amino]propyl]-C-phenylcarbonimidoyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 53483743 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | N-[N-[3-[[(2,2-dimethylpropanoylamino)-phenylmethylidene]amino]propyl]-C-phenylcarbonimidoyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)N/C(=N\CCC/N=C(\NC(=O)C(C)(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H36N4O2/c1-26(2,3)24(32)30-22(20-14-9-7-10-15-20)28-18-13-19-29-23(21-16-11-8-12-17-21)31-25(33)27(4,5)6/h7-12,14-17H,13,18-19H2,1-6H3,(H,28,30,32)(H,29,31,33) |
| InChIKey | IEHREKGXYKEJFO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|