C17H20N4 — CID 132564986
N'-[3-[[amino(phenyl)methylidene]amino]propyl]benzenecarboximidamide (PubChem CID 132564986) has the molecular formula C17H20N4 and a molecular weight of 280.38 g/mol. Its IUPAC name is N'-[3-[[amino(phenyl)methylidene]amino]propyl]benzenecarboximidamide.
| Compound Name | N'-[3-[[amino(phenyl)methylidene]amino]propyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 132564986 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | N'-[3-[[amino(phenyl)methylidene]amino]propyl]benzenecarboximidamide |
| SMILES | N/C(=N\CCC/N=C(\N)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20N4/c18-16(14-8-3-1-4-9-14)20-12-7-13-21-17(19)15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2,(H2,18,20)(H2,19,21) |
| InChIKey | HHSBWYOZJKRDNC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|