C13H14N2S — CID 63177343
N'-(2-thiophen-3-ylethyl)benzenecarboximidamide (PubChem CID 63177343) has the molecular formula C13H14N2S and a molecular weight of 230.34 g/mol. Its IUPAC name is N'-(2-thiophen-3-ylethyl)benzenecarboximidamide.
| Compound Name | N'-(2-thiophen-3-ylethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 63177343 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | N'-(2-thiophen-3-ylethyl)benzenecarboximidamide |
| SMILES | N/C(=N\CCc1ccsc1)c1ccccc1 |
| InChI | InChI=1S/C13H14N2S/c14-13(12-4-2-1-3-5-12)15-8-6-11-7-9-16-10-11/h1-5,7,9-10H,6,8H2,(H2,14,15) |
| InChIKey | WZJHMLCVDMCBEI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|