C24H29Cl2N3 — CID 3063603
4-[2-[4-(aminomethyl)phenyl]ethyl]-N'-(2-phenylethyl)benzenecarboximidamide;dihydrochloride (PubChem CID 3063603) has the molecular formula C24H29Cl2N3 and a molecular weight of 430.42 g/mol. Its IUPAC name is 4-[2-[4-(aminomethyl)phenyl]ethyl]-N'-(2-phenylethyl)benzenecarboximidamide;dihydrochloride.
| Compound Name | 4-[2-[4-(aminomethyl)phenyl]ethyl]-N'-(2-phenylethyl)benzenecarboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 3063603 |
| Molecular Formula | C24H29Cl2N3 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 4-[2-[4-(aminomethyl)phenyl]ethyl]-N'-(2-phenylethyl)benzenecarboximidamide;dihydrochloride |
| SMILES | Cl.Cl.NCc1ccc(CCc2ccc(/C(N)=N/CCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H27N3.2ClH/c25-18-22-10-8-20(9-11-22)6-7-21-12-14-23(15-13-21)24(26)27-17-16-19-4-2-1-3-5-19;;/h1-5,8-15H,6-7,16-18,25H2,(H2,26,27);2*1H |
| InChIKey | VYNPNXLZMNYSMU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|