C19H27Cl2N3O — CID 23315119
4-[2-[4-(aminomethyl)phenyl]ethyl]-N'-(2-methoxyethyl)benzenecarboximidamide;dihydrochloride (PubChem CID 23315119) has the molecular formula C19H27Cl2N3O and a molecular weight of 384.35 g/mol. Its IUPAC name is 4-[2-[4-(aminomethyl)phenyl]ethyl]-N'-(2-methoxyethyl)benzenecarboximidamide;dihydrochloride.
| Compound Name | 4-[2-[4-(aminomethyl)phenyl]ethyl]-N'-(2-methoxyethyl)benzenecarboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 23315119 |
| Molecular Formula | C19H27Cl2N3O |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-[2-[4-(aminomethyl)phenyl]ethyl]-N'-(2-methoxyethyl)benzenecarboximidamide;dihydrochloride |
| SMILES | COCC/N=C(\N)c1ccc(CCc2ccc(CN)cc2)cc1.Cl.Cl |
| InChI | InChI=1S/C19H25N3O.2ClH/c1-23-13-12-22-19(21)18-10-8-16(9-11-18)3-2-15-4-6-17(14-20)7-5-15;;/h4-11H,2-3,12-14,20H2,1H3,(H2,21,22);2*1H |
| InChIKey | UTZKXIABGCHYMK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|