About N'-(2-phenylethyl)carbamimidoselenoic acid;hydrobromide
N'-(2-phenylethyl)carbamimidoselenoic acid;hydrobromide (PubChem CID 173065239) has the molecular formula C9H13BrN2Se
and a molecular weight of 308.08 g/mol. Its IUPAC name is N'-(2-phenylethyl)carbamimidoselenoic acid;hydrobromide.
Molecular Properties
| Compound Name | N'-(2-phenylethyl)carbamimidoselenoic acid;hydrobromide |
| PubChem CID | 173065239 |
| Molecular Formula | C9H13BrN2Se |
| Molecular Weight | 308.08 g/mol |
| Exact Mass | 307.94 |
| IUPAC Name | N'-(2-phenylethyl)carbamimidoselenoic acid;hydrobromide |
| SMILES | Br.N/C([SeH])=N/CCc1ccccc1 |
| InChI | InChI=1S/C9H12N2Se.BrH/c10-9(12)11-7-6-8-4-2-1-3-5-8;/h1-5H,6-7H2,(H3,10,11,12);1H |
| InChIKey | NQJMYAWFQDBULV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.08 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-phenylethyl)carbamimidoselenoic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-phenylethyl)carbamimidoselenoic acid;hydrobromide?
The IUPAC name of N'-(2-phenylethyl)carbamimidoselenoic acid;hydrobromide (CID 173065239) is N'-(2-phenylethyl)carbamimidoselenoic acid;hydrobromide.
What is the SMILES notation for N'-(2-phenylethyl)carbamimidoselenoic acid;hydrobromide?
The canonical SMILES for N'-(2-phenylethyl)carbamimidoselenoic acid;hydrobromide is Br.N/C([SeH])=N/CCc1ccccc1.
What is the InChIKey of N'-(2-phenylethyl)carbamimidoselenoic acid;hydrobromide?
The InChIKey is NQJMYAWFQDBULV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2Se.BrH/c10-9(12)11-7-6-8-4-2-1-3-5-8;/h1-5H,6-7H2,(H3,10,11,12);1H.
What are the key properties of N'-(2-phenylethyl)carbamimidoselenoic acid;hydrobromide?
N'-(2-phenylethyl)carbamimidoselenoic acid;hydrobromide has a molecular weight of 308.08 g/mol, XLogP of 1.02, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-phenylethyl)carbamimidoselenoic acid;hydrobromide is sourced from PubChem (CID 173065239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).