C10H16ClN5 — CID 657277
1-(diaminomethylidene)-2-(2-phenylethyl)guanidine;hydron;chloride (PubChem CID 657277) has the molecular formula C10H16ClN5 and a molecular weight of 241.73 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-(2-phenylethyl)guanidine;hydron;chloride.
| Compound Name | 1-(diaminomethylidene)-2-(2-phenylethyl)guanidine;hydron;chloride |
|---|---|
| PubChem CID | 657277 |
| Molecular Formula | C10H16ClN5 |
| Molecular Weight | 241.73 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 1-(diaminomethylidene)-2-(2-phenylethyl)guanidine;hydron;chloride |
| SMILES | NC(N)=N/C(N)=N/CCc1ccccc1.[Cl-].[H+] |
| InChI | InChI=1S/C10H15N5.ClH/c11-9(12)15-10(13)14-7-6-8-4-2-1-3-5-8;/h1-5H,6-7H2,(H6,11,12,13,14,15);1H |
| InChIKey | YSUCWSWKRIOILX-UHFFFAOYSA-N |
| XLogP | -3.07 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.73 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|