C16H27N5 — CID 89147471
1-butyl-3-(diaminomethylidene)-1-ethyl-2-(2-phenylethyl)guanidine (PubChem CID 89147471) has the molecular formula C16H27N5 and a molecular weight of 289.43 g/mol. Its IUPAC name is 1-butyl-3-(diaminomethylidene)-1-ethyl-2-(2-phenylethyl)guanidine.
| Compound Name | 1-butyl-3-(diaminomethylidene)-1-ethyl-2-(2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 89147471 |
| Molecular Formula | C16H27N5 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | 1-butyl-3-(diaminomethylidene)-1-ethyl-2-(2-phenylethyl)guanidine |
| SMILES | CCCCN(CC)/C(N=C(N)N)=N/CCc1ccccc1 |
| InChI | InChI=1S/C16H27N5/c1-3-5-13-21(4-2)16(20-15(17)18)19-12-11-14-9-7-6-8-10-14/h6-10H,3-5,11-13H2,1-2H3,(H4,17,18,19,20) |
| InChIKey | FYDXRRLSDBUTRO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|