C11H17N7 — CID 154046017
1-[amino-(diaminomethylideneamino)methylidene]-2-(2-phenylethyl)guanidine (PubChem CID 154046017) has the molecular formula C11H17N7 and a molecular weight of 247.31 g/mol. Its IUPAC name is 1-[amino-(diaminomethylideneamino)methylidene]-2-(2-phenylethyl)guanidine.
| Compound Name | 1-[amino-(diaminomethylideneamino)methylidene]-2-(2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 154046017 |
| Molecular Formula | C11H17N7 |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 1-[amino-(diaminomethylideneamino)methylidene]-2-(2-phenylethyl)guanidine |
| SMILES | NC(N)=NC(N)=N/C(N)=N/CCc1ccccc1 |
| InChI | InChI=1S/C11H17N7/c12-9(13)17-11(15)18-10(14)16-7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H8,12,13,14,15,16,17,18) |
| InChIKey | HEJWQPAEJMHPQX-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|