C12H18N6O — CID 123315426
1-acetamido-2-[N'-(2-phenylethyl)carbamimidoyl]guanidine (PubChem CID 123315426) has the molecular formula C12H18N6O and a molecular weight of 262.32 g/mol. Its IUPAC name is 1-acetamido-2-[N'-(2-phenylethyl)carbamimidoyl]guanidine.
| Compound Name | 1-acetamido-2-[N'-(2-phenylethyl)carbamimidoyl]guanidine |
|---|---|
| PubChem CID | 123315426 |
| Molecular Formula | C12H18N6O |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 1-acetamido-2-[N'-(2-phenylethyl)carbamimidoyl]guanidine |
| SMILES | CC(=O)NNC(N)=N/C(N)=N/CCc1ccccc1 |
| InChI | InChI=1S/C12H18N6O/c1-9(19)17-18-12(14)16-11(13)15-8-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,17,19)(H5,13,14,15,16,18) |
| InChIKey | YULOKKOASLPKCA-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|