C13H21IN4O — CID 111027913
N-[2-[[N'-(2-phenylethyl)carbamimidoyl]amino]ethyl]acetamide;hydroiodide (PubChem CID 111027913) has the molecular formula C13H21IN4O and a molecular weight of 376.24 g/mol. Its IUPAC name is N-[2-[[N'-(2-phenylethyl)carbamimidoyl]amino]ethyl]acetamide;hydroiodide.
| Compound Name | N-[2-[[N'-(2-phenylethyl)carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111027913 |
| Molecular Formula | C13H21IN4O |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | N-[2-[[N'-(2-phenylethyl)carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
| SMILES | CC(=O)NCCN/C(N)=N/CCc1ccccc1.I |
| InChI | InChI=1S/C13H20N4O.HI/c1-11(18)15-9-10-17-13(14)16-8-7-12-5-3-2-4-6-12;/h2-6H,7-10H2,1H3,(H,15,18)(H3,14,16,17);1H |
| InChIKey | LGNARSHCCILOBA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|