C17H21ClIN3 — CID 111031333
1-[2-(3-chlorophenyl)ethyl]-2-(2-phenylethyl)guanidine;hydroiodide (PubChem CID 111031333) has the molecular formula C17H21ClIN3 and a molecular weight of 429.73 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-2-(2-phenylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-2-(2-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111031333 |
| Molecular Formula | C17H21ClIN3 |
| Molecular Weight | 429.73 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-2-(2-phenylethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCc1ccccc1)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H20ClN3.HI/c18-16-8-4-7-15(13-16)10-12-21-17(19)20-11-9-14-5-2-1-3-6-14;/h1-8,13H,9-12H2,(H3,19,20,21);1H |
| InChIKey | OVXGJWXNSNQPLX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.73 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|