C19H33N5 — CID 86657183
1-benzyl-1-ethyl-2-(N'-octylcarbamimidoyl)guanidine (PubChem CID 86657183) has the molecular formula C19H33N5 and a molecular weight of 331.51 g/mol. Its IUPAC name is 1-benzyl-1-ethyl-2-(N'-octylcarbamimidoyl)guanidine.
| Compound Name | 1-benzyl-1-ethyl-2-(N'-octylcarbamimidoyl)guanidine |
|---|---|
| PubChem CID | 86657183 |
| Molecular Formula | C19H33N5 |
| Molecular Weight | 331.51 g/mol |
| Exact Mass | 331.27 |
| IUPAC Name | 1-benzyl-1-ethyl-2-(N'-octylcarbamimidoyl)guanidine |
| SMILES | CCCCCCCC/N=C(\N)N=C(N)N(CC)Cc1ccccc1 |
| InChI | InChI=1S/C19H33N5/c1-3-5-6-7-8-12-15-22-18(20)23-19(21)24(4-2)16-17-13-10-9-11-14-17/h9-11,13-14H,3-8,12,15-16H2,1-2H3,(H4,20,21,22,23) |
| InChIKey | RRYOBWGIKPTKTE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|