C9H22ClN5 — CID 71332603
1-(diaminomethylidene)-2-heptylguanidine;hydrochloride (PubChem CID 71332603) has the molecular formula C9H22ClN5 and a molecular weight of 235.76 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-heptylguanidine;hydrochloride.
| Compound Name | 1-(diaminomethylidene)-2-heptylguanidine;hydrochloride |
|---|---|
| PubChem CID | 71332603 |
| Molecular Formula | C9H22ClN5 |
| Molecular Weight | 235.76 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 1-(diaminomethylidene)-2-heptylguanidine;hydrochloride |
| SMILES | CCCCCCC/N=C(\N)N=C(N)N.Cl |
| InChI | InChI=1S/C9H21N5.ClH/c1-2-3-4-5-6-7-13-9(12)14-8(10)11;/h2-7H2,1H3,(H6,10,11,12,13,14);1H |
| InChIKey | CRJALOTYDMDZLY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.76 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|