About N'-hexylpropanimidamide
N'-hexylpropanimidamide (PubChem CID 62048653) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is N'-hexylpropanimidamide.
Molecular Properties
| Compound Name | N'-hexylpropanimidamide |
| PubChem CID | 62048653 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | N'-hexylpropanimidamide |
| SMILES | CCCCCC/N=C(/N)CC |
| InChI | InChI=1S/C9H20N2/c1-3-5-6-7-8-11-9(10)4-2/h3-8H2,1-2H3,(H2,10,11) |
| InChIKey | ARRSPNDIDDQONI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-hexylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hexylpropanimidamide?
The IUPAC name of N'-hexylpropanimidamide (CID 62048653) is N'-hexylpropanimidamide.
What is the SMILES notation for N'-hexylpropanimidamide?
The canonical SMILES for N'-hexylpropanimidamide is CCCCCC/N=C(/N)CC.
What is the InChIKey of N'-hexylpropanimidamide?
The InChIKey is ARRSPNDIDDQONI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2/c1-3-5-6-7-8-11-9(10)4-2/h3-8H2,1-2H3,(H2,10,11).
What are the key properties of N'-hexylpropanimidamide?
N'-hexylpropanimidamide has a molecular weight of 156.27 g/mol, XLogP of 2.33, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hexylpropanimidamide is sourced from PubChem (CID 62048653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).