About N'-pentylpropanimidamide
N'-pentylpropanimidamide (PubChem CID 62047571) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is N'-pentylpropanimidamide.
Molecular Properties
| Compound Name | N'-pentylpropanimidamide |
| PubChem CID | 62047571 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | N'-pentylpropanimidamide |
| SMILES | CCCCC/N=C(/N)CC |
| InChI | InChI=1S/C8H18N2/c1-3-5-6-7-10-8(9)4-2/h3-7H2,1-2H3,(H2,9,10) |
| InChIKey | SWBLJSDYSVEURH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-pentylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-pentylpropanimidamide?
The IUPAC name of N'-pentylpropanimidamide (CID 62047571) is N'-pentylpropanimidamide.
What is the SMILES notation for N'-pentylpropanimidamide?
The canonical SMILES for N'-pentylpropanimidamide is CCCCC/N=C(/N)CC.
What is the InChIKey of N'-pentylpropanimidamide?
The InChIKey is SWBLJSDYSVEURH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2/c1-3-5-6-7-10-8(9)4-2/h3-7H2,1-2H3,(H2,9,10).
What are the key properties of N'-pentylpropanimidamide?
N'-pentylpropanimidamide has a molecular weight of 142.25 g/mol, XLogP of 1.94, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-pentylpropanimidamide is sourced from PubChem (CID 62047571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).