About methyl N'-hexylcarbamimidothioate
methyl N'-hexylcarbamimidothioate (PubChem CID 157360407) has the molecular formula C8H18N2S
and a molecular weight of 174.31 g/mol. Its IUPAC name is methyl N'-hexylcarbamimidothioate.
Molecular Properties
| Compound Name | methyl N'-hexylcarbamimidothioate |
| PubChem CID | 157360407 |
| Molecular Formula | C8H18N2S |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | methyl N'-hexylcarbamimidothioate |
| SMILES | CCCCCC/N=C(/N)SC |
| InChI | InChI=1S/C8H18N2S/c1-3-4-5-6-7-10-8(9)11-2/h3-7H2,1-2H3,(H2,9,10) |
| InChIKey | YCLQBXLJRPOSKY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-hexylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-hexylcarbamimidothioate?
The IUPAC name of methyl N'-hexylcarbamimidothioate (CID 157360407) is methyl N'-hexylcarbamimidothioate.
What is the SMILES notation for methyl N'-hexylcarbamimidothioate?
The canonical SMILES for methyl N'-hexylcarbamimidothioate is CCCCCC/N=C(/N)SC.
What is the InChIKey of methyl N'-hexylcarbamimidothioate?
The InChIKey is YCLQBXLJRPOSKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2S/c1-3-4-5-6-7-10-8(9)11-2/h3-7H2,1-2H3,(H2,9,10).
What are the key properties of methyl N'-hexylcarbamimidothioate?
methyl N'-hexylcarbamimidothioate has a molecular weight of 174.31 g/mol, XLogP of 2.24, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-hexylcarbamimidothioate is sourced from PubChem (CID 157360407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).