C12H26N2S — CID 88829700
methyl N,N'-dipentylcarbamimidothioate (PubChem CID 88829700) has the molecular formula C12H26N2S and a molecular weight of 230.42 g/mol. Its IUPAC name is methyl N,N'-dipentylcarbamimidothioate.
| Compound Name | methyl N,N'-dipentylcarbamimidothioate |
|---|---|
| PubChem CID | 88829700 |
| Molecular Formula | C12H26N2S |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | methyl N,N'-dipentylcarbamimidothioate |
| SMILES | CCCCC/N=C(/NCCCCC)SC |
| InChI | InChI=1S/C12H26N2S/c1-4-6-8-10-13-12(15-3)14-11-9-7-5-2/h4-11H2,1-3H3,(H,13,14) |
| InChIKey | VVMFJZQJKVCUFK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|