C19H41N3 — CID 173050322
1,2,3-trihexylguanidine (PubChem CID 173050322) has the molecular formula C19H41N3 and a molecular weight of 311.56 g/mol. Its IUPAC name is 1,2,3-trihexylguanidine.
| Compound Name | 1,2,3-trihexylguanidine |
|---|---|
| PubChem CID | 173050322 |
| Molecular Formula | C19H41N3 |
| Molecular Weight | 311.56 g/mol |
| Exact Mass | 311.33 |
| IUPAC Name | 1,2,3-trihexylguanidine |
| SMILES | CCCCCCN=C(NCCCCCC)NCCCCCC |
| InChI | InChI=1S/C19H41N3/c1-4-7-10-13-16-20-19(21-17-14-11-8-5-2)22-18-15-12-9-6-3/h4-18H2,1-3H3,(H2,20,21,22) |
| InChIKey | PEBAXWWWYWRGAK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|