C19H41N3O3 — CID 102441761
1,2,3-tris(5-methoxypentyl)guanidine (PubChem CID 102441761) has the molecular formula C19H41N3O3 and a molecular weight of 359.56 g/mol. Its IUPAC name is 1,2,3-tris(5-methoxypentyl)guanidine.
| Compound Name | 1,2,3-tris(5-methoxypentyl)guanidine |
|---|---|
| PubChem CID | 102441761 |
| Molecular Formula | C19H41N3O3 |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.31 |
| IUPAC Name | 1,2,3-tris(5-methoxypentyl)guanidine |
| SMILES | COCCCCCN=C(NCCCCCOC)NCCCCCOC |
| InChI | InChI=1S/C19H41N3O3/c1-23-16-10-4-7-13-20-19(21-14-8-5-11-17-24-2)22-15-9-6-12-18-25-3/h4-18H2,1-3H3,(H2,20,21,22) |
| InChIKey | RPPVPYTXPJJGGO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|