C15H32N2 — CID 88678498
N,N'-dipentylpentanimidamide (PubChem CID 88678498) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is N,N'-dipentylpentanimidamide.
| Compound Name | N,N'-dipentylpentanimidamide |
|---|---|
| PubChem CID | 88678498 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | N,N'-dipentylpentanimidamide |
| SMILES | CCCCC/N=C(\CCCC)NCCCCC |
| InChI | InChI=1S/C15H32N2/c1-4-7-10-13-16-15(12-9-6-3)17-14-11-8-5-2/h4-14H2,1-3H3,(H,16,17) |
| InChIKey | WGIBERJUDBPOOQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|