C18H38N2O2 — CID 88679605
N,N'-bis(2-ethoxyethyl)decanimidamide (PubChem CID 88679605) has the molecular formula C18H38N2O2 and a molecular weight of 314.51 g/mol. Its IUPAC name is N,N'-bis(2-ethoxyethyl)decanimidamide.
| Compound Name | N,N'-bis(2-ethoxyethyl)decanimidamide |
|---|---|
| PubChem CID | 88679605 |
| Molecular Formula | C18H38N2O2 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.29 |
| IUPAC Name | N,N'-bis(2-ethoxyethyl)decanimidamide |
| SMILES | CCCCCCCCC/C(=N\CCOCC)NCCOCC |
| InChI | InChI=1S/C18H38N2O2/c1-4-7-8-9-10-11-12-13-18(19-14-16-21-5-2)20-15-17-22-6-3/h4-17H2,1-3H3,(H,19,20) |
| InChIKey | ZIRVKJFMHJLNAG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|