About N-butyl-N'-propylbutanimidamide;carbonic acid
N-butyl-N'-propylbutanimidamide;carbonic acid (PubChem CID 175099903) has the molecular formula C12H26N2O3
and a molecular weight of 246.35 g/mol. Its IUPAC name is N-butyl-N'-propylbutanimidamide;carbonic acid.
Molecular Properties
| Compound Name | N-butyl-N'-propylbutanimidamide;carbonic acid |
| PubChem CID | 175099903 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | N-butyl-N'-propylbutanimidamide;carbonic acid |
| SMILES | CCCCN/C(CCC)=N/CCC.O=C(O)O |
| InChI | InChI=1S/C11H24N2.CH2O3/c1-4-7-10-13-11(8-5-2)12-9-6-3;2-1(3)4/h4-10H2,1-3H3,(H,12,13);(H2,2,3,4) |
| InChIKey | NABGKEBHCDEFER-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N'-propylbutanimidamide;carbonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N'-propylbutanimidamide;carbonic acid?
The IUPAC name of N-butyl-N'-propylbutanimidamide;carbonic acid (CID 175099903) is N-butyl-N'-propylbutanimidamide;carbonic acid.
What is the SMILES notation for N-butyl-N'-propylbutanimidamide;carbonic acid?
The canonical SMILES for N-butyl-N'-propylbutanimidamide;carbonic acid is CCCCN/C(CCC)=N/CCC.O=C(O)O.
What is the InChIKey of N-butyl-N'-propylbutanimidamide;carbonic acid?
The InChIKey is NABGKEBHCDEFER-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2.CH2O3/c1-4-7-10-13-11(8-5-2)12-9-6-3;2-1(3)4/h4-10H2,1-3H3,(H,12,13);(H2,2,3,4).
What are the key properties of N-butyl-N'-propylbutanimidamide;carbonic acid?
N-butyl-N'-propylbutanimidamide;carbonic acid has a molecular weight of 246.35 g/mol, XLogP of 3.21, 7 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N'-propylbutanimidamide;carbonic acid is sourced from PubChem (CID 175099903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).