About N-amino-N'-propyldecanimidamide
N-amino-N'-propyldecanimidamide (PubChem CID 65427177) has the molecular formula C13H29N3
and a molecular weight of 227.40 g/mol. Its IUPAC name is N-amino-N'-propyldecanimidamide.
Molecular Properties
| Compound Name | N-amino-N'-propyldecanimidamide |
| PubChem CID | 65427177 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | N-amino-N'-propyldecanimidamide |
| SMILES | CCCCCCCCC/C(=N\CCC)NN |
| InChI | InChI=1S/C13H29N3/c1-3-5-6-7-8-9-10-11-13(16-14)15-12-4-2/h3-12,14H2,1-2H3,(H,15,16) |
| InChIKey | IAUSJOWVTNQCTK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N'-propyldecanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N'-propyldecanimidamide?
The IUPAC name of N-amino-N'-propyldecanimidamide (CID 65427177) is N-amino-N'-propyldecanimidamide.
What is the SMILES notation for N-amino-N'-propyldecanimidamide?
The canonical SMILES for N-amino-N'-propyldecanimidamide is CCCCCCCCC/C(=N\CCC)NN.
What is the InChIKey of N-amino-N'-propyldecanimidamide?
The InChIKey is IAUSJOWVTNQCTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N3/c1-3-5-6-7-8-9-10-11-13(16-14)15-12-4-2/h3-12,14H2,1-2H3,(H,15,16).
What are the key properties of N-amino-N'-propyldecanimidamide?
N-amino-N'-propyldecanimidamide has a molecular weight of 227.40 g/mol, XLogP of 3.40, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N'-propyldecanimidamide is sourced from PubChem (CID 65427177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).