About N-amino-N'-ethyldecanimidamide
N-amino-N'-ethyldecanimidamide (PubChem CID 65427174) has the molecular formula C12H27N3
and a molecular weight of 213.37 g/mol. Its IUPAC name is N-amino-N'-ethyldecanimidamide.
Molecular Properties
| Compound Name | N-amino-N'-ethyldecanimidamide |
| PubChem CID | 65427174 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | N-amino-N'-ethyldecanimidamide |
| SMILES | CCCCCCCCC/C(=N\CC)NN |
| InChI | InChI=1S/C12H27N3/c1-3-5-6-7-8-9-10-11-12(15-13)14-4-2/h3-11,13H2,1-2H3,(H,14,15) |
| InChIKey | FNRGDMVIMIUVLH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N'-ethyldecanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N'-ethyldecanimidamide?
The IUPAC name of N-amino-N'-ethyldecanimidamide (CID 65427174) is N-amino-N'-ethyldecanimidamide.
What is the SMILES notation for N-amino-N'-ethyldecanimidamide?
The canonical SMILES for N-amino-N'-ethyldecanimidamide is CCCCCCCCC/C(=N\CC)NN.
What is the InChIKey of N-amino-N'-ethyldecanimidamide?
The InChIKey is FNRGDMVIMIUVLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N3/c1-3-5-6-7-8-9-10-11-12(15-13)14-4-2/h3-11,13H2,1-2H3,(H,14,15).
What are the key properties of N-amino-N'-ethyldecanimidamide?
N-amino-N'-ethyldecanimidamide has a molecular weight of 213.37 g/mol, XLogP of 3.01, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N'-ethyldecanimidamide is sourced from PubChem (CID 65427174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).