C18H38N4 — CID 45484696
1-N',14-N'-diethyltetradecanediimidamide (PubChem CID 45484696) has the molecular formula C18H38N4 and a molecular weight of 310.53 g/mol. Its IUPAC name is 1-N',14-N'-diethyltetradecanediimidamide.
| Compound Name | 1-N',14-N'-diethyltetradecanediimidamide |
|---|---|
| PubChem CID | 45484696 |
| Molecular Formula | C18H38N4 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.31 |
| IUPAC Name | 1-N',14-N'-diethyltetradecanediimidamide |
| SMILES | CC/N=C(\N)CCCCCCCCCCCC/C(N)=N\CC |
| InChI | InChI=1S/C18H38N4/c1-3-21-17(19)15-13-11-9-7-5-6-8-10-12-14-16-18(20)22-4-2/h3-16H2,1-2H3,(H2,19,21)(H2,20,22) |
| InChIKey | PUTCZONAUAKYKN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|