C9H18F2N2O — CID 156800054
9,9-difluoro-N'-hydroxynonanimidamide (PubChem CID 156800054) has the molecular formula C9H18F2N2O and a molecular weight of 208.25 g/mol. Its IUPAC name is 9,9-difluoro-N'-hydroxynonanimidamide.
| Compound Name | 9,9-difluoro-N'-hydroxynonanimidamide |
|---|---|
| PubChem CID | 156800054 |
| Molecular Formula | C9H18F2N2O |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 9,9-difluoro-N'-hydroxynonanimidamide |
| SMILES | N/C(CCCCCCCC(F)F)=N\O |
| InChI | InChI=1S/C9H18F2N2O/c10-8(11)6-4-2-1-3-5-7-9(12)13-14/h8,14H,1-7H2,(H2,12,13) |
| InChIKey | IPDKCSNEALGOEI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|