C27H56N8 — CID 140591662
1-N',9-N'-bis[N'-(2-ethylhexyl)carbamimidoyl]nonanediimidamide (PubChem CID 140591662) has the molecular formula C27H56N8 and a molecular weight of 492.80 g/mol. Its IUPAC name is 1-N',9-N'-bis[N'-(2-ethylhexyl)carbamimidoyl]nonanediimidamide.
| Compound Name | 1-N',9-N'-bis[N'-(2-ethylhexyl)carbamimidoyl]nonanediimidamide |
|---|---|
| PubChem CID | 140591662 |
| Molecular Formula | C27H56N8 |
| Molecular Weight | 492.80 g/mol |
| Exact Mass | 492.46 |
| IUPAC Name | 1-N',9-N'-bis[N'-(2-ethylhexyl)carbamimidoyl]nonanediimidamide |
| SMILES | CCCCC(CC)C/N=C(\N)N=C(N)CCCCCCCC(N)=N/C(N)=N/CC(CC)CCCC |
| InChI | InChI=1S/C27H56N8/c1-5-9-16-22(7-3)20-32-26(30)34-24(28)18-14-12-11-13-15-19-25(29)35-27(31)33-21-23(8-4)17-10-6-2/h22-23H,5-21H2,1-4H3,(H4,28,30,32,34)(H4,29,31,33,35) |
| InChIKey | GLALNDSRYMFMMH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 153.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.80 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|