C21H41N3 — CID 19826639
1,1-dicyclohexyl-2-(2-ethylhexyl)guanidine (PubChem CID 19826639) has the molecular formula C21H41N3 and a molecular weight of 335.58 g/mol. Its IUPAC name is 1,1-dicyclohexyl-2-(2-ethylhexyl)guanidine.
| Compound Name | 1,1-dicyclohexyl-2-(2-ethylhexyl)guanidine |
|---|---|
| PubChem CID | 19826639 |
| Molecular Formula | C21H41N3 |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.33 |
| IUPAC Name | 1,1-dicyclohexyl-2-(2-ethylhexyl)guanidine |
| SMILES | CCCCC(CC)C/N=C(\N)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C21H41N3/c1-3-5-12-18(4-2)17-23-21(22)24(19-13-8-6-9-14-19)20-15-10-7-11-16-20/h18-20H,3-17H2,1-2H3,(H2,22,23) |
| InChIKey | MWEUXNNXDSTFQO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|