C10H24ClN5 — CID 176518157
1-carbamimidoyl-2-(2-ethylhexyl)guanidine;hydrochloride (PubChem CID 176518157) has the molecular formula C10H24ClN5 and a molecular weight of 249.79 g/mol. Its IUPAC name is 1-carbamimidoyl-2-(2-ethylhexyl)guanidine;hydrochloride.
| Compound Name | 1-carbamimidoyl-2-(2-ethylhexyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 176518157 |
| Molecular Formula | C10H24ClN5 |
| Molecular Weight | 249.79 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 1-carbamimidoyl-2-(2-ethylhexyl)guanidine;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N/C(N)=N/CC(CC)CCCC |
| InChI | InChI=1S/C10H23N5.ClH/c1-3-5-6-8(4-2)7-14-10(13)15-9(11)12;/h8H,3-7H2,1-2H3,(H6,11,12,13,14,15);1H |
| InChIKey | DXSBUCPFFVHNST-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.79 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|