C26H55N9 — CID 87517335
N-[N'-[6-[[amino-[[N'-(2-ethylhexyl)carbamimidoyl]amino]methylidene]amino]hexyl]carbamimidoyl]-N'-(2-ethylhexyl)methanimidamide (PubChem CID 87517335) has the molecular formula C26H55N9 and a molecular weight of 493.79 g/mol. Its IUPAC name is N-[N'-[6-[[amino-[[N'-(2-ethylhexyl)carbamimidoyl]amino]methylidene]amino]hexyl]carbamimidoyl]-N'-(2-ethylhexyl)methanimidamide.
| Compound Name | N-[N'-[6-[[amino-[[N'-(2-ethylhexyl)carbamimidoyl]amino]methylidene]amino]hexyl]carbamimidoyl]-N'-(2-ethylhexyl)methanimidamide |
|---|---|
| PubChem CID | 87517335 |
| Molecular Formula | C26H55N9 |
| Molecular Weight | 493.79 g/mol |
| Exact Mass | 493.46 |
| IUPAC Name | N-[N'-[6-[[amino-[[N'-(2-ethylhexyl)carbamimidoyl]amino]methylidene]amino]hexyl]carbamimidoyl]-N'-(2-ethylhexyl)methanimidamide |
| SMILES | CCCCC(CC)C/N=C/N/C(N)=N/CCCCCC/N=C(\N)N/C(N)=N/CC(CC)CCCC |
| InChI | InChI=1S/C26H55N9/c1-5-9-15-22(7-3)19-30-21-34-24(27)31-17-13-11-12-14-18-32-25(28)35-26(29)33-20-23(8-4)16-10-6-2/h21-23H,5-20H2,1-4H3,(H3,27,30,31,34)(H5,28,29,32,33,35) |
| InChIKey | BZDLXCWTGYLXAN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 151.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.79 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|