C8H18N4O — CID 87601330
(N'-hexylcarbamimidoyl)urea (PubChem CID 87601330) has the molecular formula C8H18N4O and a molecular weight of 186.26 g/mol. Its IUPAC name is (N'-hexylcarbamimidoyl)urea.
| Compound Name | (N'-hexylcarbamimidoyl)urea |
|---|---|
| PubChem CID | 87601330 |
| Molecular Formula | C8H18N4O |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | (N'-hexylcarbamimidoyl)urea |
| SMILES | CCCCCC/N=C(\N)NC(N)=O |
| InChI | InChI=1S/C8H18N4O/c1-2-3-4-5-6-11-7(9)12-8(10)13/h2-6H2,1H3,(H5,9,10,11,12,13) |
| InChIKey | NQPHCVSBRKZJMC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|