C16H35N5 — CID 134103287
1-(N'-hexylcarbamimidoyl)-2-(2,4,4-trimethylpentan-2-yl)guanidine (PubChem CID 134103287) has the molecular formula C16H35N5 and a molecular weight of 297.49 g/mol. Its IUPAC name is 1-(N'-hexylcarbamimidoyl)-2-(2,4,4-trimethylpentan-2-yl)guanidine.
| Compound Name | 1-(N'-hexylcarbamimidoyl)-2-(2,4,4-trimethylpentan-2-yl)guanidine |
|---|---|
| PubChem CID | 134103287 |
| Molecular Formula | C16H35N5 |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.29 |
| IUPAC Name | 1-(N'-hexylcarbamimidoyl)-2-(2,4,4-trimethylpentan-2-yl)guanidine |
| SMILES | CCCCCC/N=C(\N)N/C(N)=N/C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C16H35N5/c1-7-8-9-10-11-19-13(17)20-14(18)21-16(5,6)12-15(2,3)4/h7-12H2,1-6H3,(H5,17,18,19,20,21) |
| InChIKey | VYTQVTATQJIGBR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|