C17H37N3 — CID 141123572
2-hexyl-1-(2,3,3-trimethylheptan-2-yl)guanidine (PubChem CID 141123572) has the molecular formula C17H37N3 and a molecular weight of 283.50 g/mol. Its IUPAC name is 2-hexyl-1-(2,3,3-trimethylheptan-2-yl)guanidine.
| Compound Name | 2-hexyl-1-(2,3,3-trimethylheptan-2-yl)guanidine |
|---|---|
| PubChem CID | 141123572 |
| Molecular Formula | C17H37N3 |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.30 |
| IUPAC Name | 2-hexyl-1-(2,3,3-trimethylheptan-2-yl)guanidine |
| SMILES | CCCCCC/N=C(\N)NC(C)(C)C(C)(C)CCCC |
| InChI | InChI=1S/C17H37N3/c1-7-9-11-12-14-19-15(18)20-17(5,6)16(3,4)13-10-8-2/h7-14H2,1-6H3,(H3,18,19,20) |
| InChIKey | NVUPMFUATGEXST-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|