C10H23N3O — CID 106190240
1-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-propylguanidine (PubChem CID 106190240) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-propylguanidine.
| Compound Name | 1-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-propylguanidine |
|---|---|
| PubChem CID | 106190240 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | 1-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-propylguanidine |
| SMILES | CCC/N=C(\N)NC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C10H23N3O/c1-6-7-12-8(11)13-9(2,3)10(4,5)14/h14H,6-7H2,1-5H3,(H3,11,12,13) |
| InChIKey | QADFIENJOJDTOP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|