C8H19N5O — CID 104885506
2-[(N-amino-N'-propylcarbamimidoyl)amino]-2-methylpropanamide (PubChem CID 104885506) has the molecular formula C8H19N5O and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-[(N-amino-N'-propylcarbamimidoyl)amino]-2-methylpropanamide.
| Compound Name | 2-[(N-amino-N'-propylcarbamimidoyl)amino]-2-methylpropanamide |
|---|---|
| PubChem CID | 104885506 |
| Molecular Formula | C8H19N5O |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | 2-[(N-amino-N'-propylcarbamimidoyl)amino]-2-methylpropanamide |
| SMILES | CCC/N=C(\NN)NC(C)(C)C(N)=O |
| InChI | InChI=1S/C8H19N5O/c1-4-5-11-7(13-10)12-8(2,3)6(9)14/h4-5,10H2,1-3H3,(H2,9,14)(H2,11,12,13) |
| InChIKey | QLCZNVJBBQAMOW-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|