C12H27N3 — CID 62378563
2-propyl-1-(2,4,4-trimethylpentan-2-yl)guanidine (PubChem CID 62378563) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is 2-propyl-1-(2,4,4-trimethylpentan-2-yl)guanidine.
| Compound Name | 2-propyl-1-(2,4,4-trimethylpentan-2-yl)guanidine |
|---|---|
| PubChem CID | 62378563 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | 2-propyl-1-(2,4,4-trimethylpentan-2-yl)guanidine |
| SMILES | CCC/N=C(\N)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C12H27N3/c1-7-8-14-10(13)15-12(5,6)9-11(2,3)4/h7-9H2,1-6H3,(H3,13,14,15) |
| InChIKey | IMGNSCOQLQXUBF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|