C12H26N2S — CID 17276889
1-propyl-3-(2,4,4-trimethylpentan-2-yl)thiourea (PubChem CID 17276889) has the molecular formula C12H26N2S and a molecular weight of 230.42 g/mol. Its IUPAC name is 1-propyl-3-(2,4,4-trimethylpentan-2-yl)thiourea.
| Compound Name | 1-propyl-3-(2,4,4-trimethylpentan-2-yl)thiourea |
|---|---|
| PubChem CID | 17276889 |
| Molecular Formula | C12H26N2S |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-propyl-3-(2,4,4-trimethylpentan-2-yl)thiourea |
| SMILES | CCCNC(=S)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C12H26N2S/c1-7-8-13-10(15)14-12(5,6)9-11(2,3)4/h7-9H2,1-6H3,(H2,13,14,15) |
| InChIKey | FADGEEMFOLVQBM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|