C16H33N3S — CID 3401312
1-(2-piperidin-1-ylethyl)-3-(2,4,4-trimethylpentan-2-yl)thiourea (PubChem CID 3401312) has the molecular formula C16H33N3S and a molecular weight of 299.53 g/mol. Its IUPAC name is 1-(2-piperidin-1-ylethyl)-3-(2,4,4-trimethylpentan-2-yl)thiourea.
| Compound Name | 1-(2-piperidin-1-ylethyl)-3-(2,4,4-trimethylpentan-2-yl)thiourea |
|---|---|
| PubChem CID | 3401312 |
| Molecular Formula | C16H33N3S |
| Molecular Weight | 299.53 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 1-(2-piperidin-1-ylethyl)-3-(2,4,4-trimethylpentan-2-yl)thiourea |
| SMILES | CC(C)(C)CC(C)(C)NC(=S)NCCN1CCCCC1 |
| InChI | InChI=1S/C16H33N3S/c1-15(2,3)13-16(4,5)18-14(20)17-9-12-19-10-7-6-8-11-19/h6-13H2,1-5H3,(H2,17,18,20) |
| InChIKey | DZHODQUFUQXSJV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|