C16H25N3S — CID 2970670
1-(1-phenylethyl)-3-(2-piperidin-1-ylethyl)thiourea (PubChem CID 2970670) has the molecular formula C16H25N3S and a molecular weight of 291.46 g/mol. Its IUPAC name is 1-(1-phenylethyl)-3-(2-piperidin-1-ylethyl)thiourea.
| Compound Name | 1-(1-phenylethyl)-3-(2-piperidin-1-ylethyl)thiourea |
|---|---|
| PubChem CID | 2970670 |
| Molecular Formula | C16H25N3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 1-(1-phenylethyl)-3-(2-piperidin-1-ylethyl)thiourea |
| SMILES | CC(NC(=S)NCCN1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C16H25N3S/c1-14(15-8-4-2-5-9-15)18-16(20)17-10-13-19-11-6-3-7-12-19/h2,4-5,8-9,14H,3,6-7,10-13H2,1H3,(H2,17,18,20) |
| InChIKey | GENACJVSBSVXJY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|