C16H25ClN2S — CID 19652264
1-[(4-chlorophenyl)methyl]-3-(2,4,4-trimethylpentan-2-yl)thiourea (PubChem CID 19652264) has the molecular formula C16H25ClN2S and a molecular weight of 312.91 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-(2,4,4-trimethylpentan-2-yl)thiourea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-(2,4,4-trimethylpentan-2-yl)thiourea |
|---|---|
| PubChem CID | 19652264 |
| Molecular Formula | C16H25ClN2S |
| Molecular Weight | 312.91 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-(2,4,4-trimethylpentan-2-yl)thiourea |
| SMILES | CC(C)(C)CC(C)(C)NC(=S)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H25ClN2S/c1-15(2,3)11-16(4,5)19-14(20)18-10-12-6-8-13(17)9-7-12/h6-9H,10-11H2,1-5H3,(H2,18,19,20) |
| InChIKey | VPASGLYUYXHJCV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.91 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|